C18H32Cl2N6O — CID 119393580
N-(3-piperazin-1-ylpropyl)-2-(4-pyridin-2-ylpiperazin-1-yl)acetamide;dihydrochloride (PubChem CID 119393580) has the molecular formula C18H32Cl2N6O and a molecular weight of 419.40 g/mol. Its IUPAC name is N-(3-piperazin-1-ylpropyl)-2-(4-pyridin-2-ylpiperazin-1-yl)acetamide;dihydrochloride.
| Compound Name | N-(3-piperazin-1-ylpropyl)-2-(4-pyridin-2-ylpiperazin-1-yl)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119393580 |
| Molecular Formula | C18H32Cl2N6O |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | N-(3-piperazin-1-ylpropyl)-2-(4-pyridin-2-ylpiperazin-1-yl)acetamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(CN1CCN(c2ccccn2)CC1)NCCCN1CCNCC1 |
| InChI | InChI=1S/C18H30N6O.2ClH/c25-18(21-6-3-9-22-10-7-19-8-11-22)16-23-12-14-24(15-13-23)17-4-1-2-5-20-17;;/h1-2,4-5,19H,3,6-16H2,(H,21,25);2*1H |
| InChIKey | DUISPMOSDAISQR-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 63.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|