C21H22ClN3O3S — CID 46563110
2-[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]-1-(2-methyl-1H-indol-3-yl)ethanone (PubChem CID 46563110) has the molecular formula C21H22ClN3O3S and a molecular weight of 431.95 g/mol. Its IUPAC name is 2-[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]-1-(2-methyl-1H-indol-3-yl)ethanone.
| Compound Name | 2-[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]-1-(2-methyl-1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 46563110 |
| Molecular Formula | C21H22ClN3O3S |
| Molecular Weight | 431.95 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | 2-[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]-1-(2-methyl-1H-indol-3-yl)ethanone |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)CN1CCN(S(=O)(=O)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C21H22ClN3O3S/c1-15-21(16-6-2-4-8-18(16)23-15)19(26)14-24-10-12-25(13-11-24)29(27,28)20-9-5-3-7-17(20)22/h2-9,23H,10-14H2,1H3 |
| InChIKey | YBZGMBQYNKPEKZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.95 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |