C20H18ClNO5S — CID 3692012
[2-(2-methyl-1H-indol-3-yl)-2-oxoethyl] 3-(2-chlorophenyl)sulfonylpropanoate (PubChem CID 3692012) has the molecular formula C20H18ClNO5S and a molecular weight of 419.89 g/mol. Its IUPAC name is [2-(2-methyl-1H-indol-3-yl)-2-oxoethyl] 3-(2-chlorophenyl)sulfonylpropanoate.
| Compound Name | [2-(2-methyl-1H-indol-3-yl)-2-oxoethyl] 3-(2-chlorophenyl)sulfonylpropanoate |
|---|---|
| PubChem CID | 3692012 |
| Molecular Formula | C20H18ClNO5S |
| Molecular Weight | 419.89 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | [2-(2-methyl-1H-indol-3-yl)-2-oxoethyl] 3-(2-chlorophenyl)sulfonylpropanoate |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)COC(=O)CCS(=O)(=O)c1ccccc1Cl |
| InChI | InChI=1S/C20H18ClNO5S/c1-13-20(14-6-2-4-8-16(14)22-13)17(23)12-27-19(24)10-11-28(25,26)18-9-5-3-7-15(18)21/h2-9,22H,10-12H2,1H3 |
| InChIKey | CDRMNKLGHCIZOY-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.89 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |