C22H32N4O3S — CID 55626329
N-cyclohexyl-N-methyl-4-[2-(2-methyl-1H-indol-3-yl)-2-oxoethyl]piperazine-1-sulfonamide (PubChem CID 55626329) has the molecular formula C22H32N4O3S and a molecular weight of 432.59 g/mol. Its IUPAC name is N-cyclohexyl-N-methyl-4-[2-(2-methyl-1H-indol-3-yl)-2-oxoethyl]piperazine-1-sulfonamide.
| Compound Name | N-cyclohexyl-N-methyl-4-[2-(2-methyl-1H-indol-3-yl)-2-oxoethyl]piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 55626329 |
| Molecular Formula | C22H32N4O3S |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | N-cyclohexyl-N-methyl-4-[2-(2-methyl-1H-indol-3-yl)-2-oxoethyl]piperazine-1-sulfonamide |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)CN1CCN(S(=O)(=O)N(C)C2CCCCC2)CC1 |
| InChI | InChI=1S/C22H32N4O3S/c1-17-22(19-10-6-7-11-20(19)23-17)21(27)16-25-12-14-26(15-13-25)30(28,29)24(2)18-8-4-3-5-9-18/h6-7,10-11,18,23H,3-5,8-9,12-16H2,1-2H3 |
| InChIKey | JJYXOKUVVCXWOT-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |