C18H16Cl2N2O3S — CID 7626269
(5R)-5-(2,4-dichlorophenyl)-3-[2-(2,5-dimethylthiophen-3-yl)-2-oxoethyl]-5-methylimidazolidine-2,4-dione (PubChem CID 7626269) has the molecular formula C18H16Cl2N2O3S and a molecular weight of 411.31 g/mol. Its IUPAC name is (5R)-5-(2,4-dichlorophenyl)-3-[2-(2,5-dimethylthiophen-3-yl)-2-oxoethyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-(2,4-dichlorophenyl)-3-[2-(2,5-dimethylthiophen-3-yl)-2-oxoethyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 7626269 |
| Molecular Formula | C18H16Cl2N2O3S |
| Molecular Weight | 411.31 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | (5R)-5-(2,4-dichlorophenyl)-3-[2-(2,5-dimethylthiophen-3-yl)-2-oxoethyl]-5-methylimidazolidine-2,4-dione |
| SMILES | Cc1cc(C(=O)CN2C(=O)N[C@](C)(c3ccc(Cl)cc3Cl)C2=O)c(C)s1 |
| InChI | InChI=1S/C18H16Cl2N2O3S/c1-9-6-12(10(2)26-9)15(23)8-22-16(24)18(3,21-17(22)25)13-5-4-11(19)7-14(13)20/h4-7H,8H2,1-3H3,(H,21,25)/t18-/m1/s1 |
| InChIKey | KQZKLDGFPUSZKJ-GOSISDBHSA-N |
| XLogP | 4.32 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.31 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|