C16H18Cl2N2O4 — CID 124872753
(5S)-5-(2,4-dichlorophenyl)-3-(3-methoxy-3-methyl-2-oxobutyl)-5-methylimidazolidine-2,4-dione (PubChem CID 124872753) has the molecular formula C16H18Cl2N2O4 and a molecular weight of 373.24 g/mol. Its IUPAC name is (5S)-5-(2,4-dichlorophenyl)-3-(3-methoxy-3-methyl-2-oxobutyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | (5S)-5-(2,4-dichlorophenyl)-3-(3-methoxy-3-methyl-2-oxobutyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 124872753 |
| Molecular Formula | C16H18Cl2N2O4 |
| Molecular Weight | 373.24 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | (5S)-5-(2,4-dichlorophenyl)-3-(3-methoxy-3-methyl-2-oxobutyl)-5-methylimidazolidine-2,4-dione |
| SMILES | COC(C)(C)C(=O)CN1C(=O)N[C@@](C)(c2ccc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C16H18Cl2N2O4/c1-15(2,24-4)12(21)8-20-13(22)16(3,19-14(20)23)10-6-5-9(17)7-11(10)18/h5-7H,8H2,1-4H3,(H,19,23)/t16-/m0/s1 |
| InChIKey | QNZZXHVPCLPCPE-INIZCTEOSA-N |
| XLogP | 2.75 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.24 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|