C25H24N4O3 — CID 46818021
4-[4-methyl-2,5-dioxo-1-[(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl]imidazolidin-4-yl]benzonitrile (PubChem CID 46818021) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is 4-[4-methyl-2,5-dioxo-1-[(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl]imidazolidin-4-yl]benzonitrile.
| Compound Name | 4-[4-methyl-2,5-dioxo-1-[(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl]imidazolidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 46818021 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 4-[4-methyl-2,5-dioxo-1-[(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl]imidazolidin-4-yl]benzonitrile |
| SMILES | CN1/C(=C\C(=O)CN2C(=O)NC(C)(c3ccc(C#N)cc3)C2=O)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C25H24N4O3/c1-24(2)19-7-5-6-8-20(19)28(4)21(24)13-18(30)15-29-22(31)25(3,27-23(29)32)17-11-9-16(14-26)10-12-17/h5-13H,15H2,1-4H3,(H,27,32)/b21-13- |
| InChIKey | RMZXPOYHYQUOSG-BKUYFWCQSA-N |
| XLogP | 3.21 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|