C23H24Cl2N2O4S — CID 5067405
1-(2,4-dichloro-5-morpholin-4-ylsulfonylphenyl)-2-(1,3,3-trimethylindol-2-ylidene)ethanone (PubChem CID 5067405) has the molecular formula C23H24Cl2N2O4S and a molecular weight of 495.43 g/mol. Its IUPAC name is 1-(2,4-dichloro-5-morpholin-4-ylsulfonylphenyl)-2-(1,3,3-trimethylindol-2-ylidene)ethanone.
| Compound Name | 1-(2,4-dichloro-5-morpholin-4-ylsulfonylphenyl)-2-(1,3,3-trimethylindol-2-ylidene)ethanone |
|---|---|
| PubChem CID | 5067405 |
| Molecular Formula | C23H24Cl2N2O4S |
| Molecular Weight | 495.43 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | 1-(2,4-dichloro-5-morpholin-4-ylsulfonylphenyl)-2-(1,3,3-trimethylindol-2-ylidene)ethanone |
| SMILES | CN1C(=CC(=O)c2cc(S(=O)(=O)N3CCOCC3)c(Cl)cc2Cl)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C23H24Cl2N2O4S/c1-23(2)16-6-4-5-7-19(16)26(3)22(23)14-20(28)15-12-21(18(25)13-17(15)24)32(29,30)27-8-10-31-11-9-27/h4-7,12-14H,8-11H2,1-3H3 |
| InChIKey | REXJCXFSHSQLIN-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.43 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|