C17H14Cl4N2O4S — CID 55345927
2,4-dichloro-N-(2,3-dichlorophenyl)-5-morpholin-4-ylsulfonylbenzamide (PubChem CID 55345927) has the molecular formula C17H14Cl4N2O4S and a molecular weight of 484.19 g/mol. Its IUPAC name is 2,4-dichloro-N-(2,3-dichlorophenyl)-5-morpholin-4-ylsulfonylbenzamide.
| Compound Name | 2,4-dichloro-N-(2,3-dichlorophenyl)-5-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55345927 |
| Molecular Formula | C17H14Cl4N2O4S |
| Molecular Weight | 484.19 g/mol |
| Exact Mass | 481.94 |
| IUPAC Name | 2,4-dichloro-N-(2,3-dichlorophenyl)-5-morpholin-4-ylsulfonylbenzamide |
| SMILES | O=C(Nc1cccc(Cl)c1Cl)c1cc(S(=O)(=O)N2CCOCC2)c(Cl)cc1Cl |
| InChI | InChI=1S/C17H14Cl4N2O4S/c18-11-2-1-3-14(16(11)21)22-17(24)10-8-15(13(20)9-12(10)19)28(25,26)23-4-6-27-7-5-23/h1-3,8-9H,4-7H2,(H,22,24) |
| InChIKey | XIVYZSANRHRCNW-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.19 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |