C16H15Cl2N3O5S2 — CID 55435294
N-(4-acetyl-1,3-thiazol-2-yl)-2,4-dichloro-5-morpholin-4-ylsulfonylbenzamide (PubChem CID 55435294) has the molecular formula C16H15Cl2N3O5S2 and a molecular weight of 464.35 g/mol. Its IUPAC name is N-(4-acetyl-1,3-thiazol-2-yl)-2,4-dichloro-5-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-(4-acetyl-1,3-thiazol-2-yl)-2,4-dichloro-5-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55435294 |
| Molecular Formula | C16H15Cl2N3O5S2 |
| Molecular Weight | 464.35 g/mol |
| Exact Mass | 462.98 |
| IUPAC Name | N-(4-acetyl-1,3-thiazol-2-yl)-2,4-dichloro-5-morpholin-4-ylsulfonylbenzamide |
| SMILES | CC(=O)c1csc(NC(=O)c2cc(S(=O)(=O)N3CCOCC3)c(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C16H15Cl2N3O5S2/c1-9(22)13-8-27-16(19-13)20-15(23)10-6-14(12(18)7-11(10)17)28(24,25)21-2-4-26-5-3-21/h6-8H,2-5H2,1H3,(H,19,20,23) |
| InChIKey | FTGJHFHQLKZQME-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |