C25H29N3O4S2 — CID 2423053
4-methyl-3-morpholin-4-ylsulfonyl-N-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethanethioyl]benzamide (PubChem CID 2423053) has the molecular formula C25H29N3O4S2 and a molecular weight of 499.66 g/mol. Its IUPAC name is 4-methyl-3-morpholin-4-ylsulfonyl-N-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethanethioyl]benzamide.
| Compound Name | 4-methyl-3-morpholin-4-ylsulfonyl-N-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethanethioyl]benzamide |
|---|---|
| PubChem CID | 2423053 |
| Molecular Formula | C25H29N3O4S2 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | 4-methyl-3-morpholin-4-ylsulfonyl-N-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethanethioyl]benzamide |
| SMILES | Cc1ccc(C(=O)NC(=S)/C=C2\N(C)c3ccccc3C2(C)C)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C25H29N3O4S2/c1-17-9-10-18(15-21(17)34(30,31)28-11-13-32-14-12-28)24(29)26-23(33)16-22-25(2,3)19-7-5-6-8-20(19)27(22)4/h5-10,15-16H,11-14H2,1-4H3,(H,26,29,33)/b22-16- |
| InChIKey | MUHDZLKDKKQTSL-JWGURIENSA-N |
| XLogP | 3.38 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|