C25H28N2O6S — CID 2642129
[(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 3-morpholin-4-ylsulfonylbenzoate (PubChem CID 2642129) has the molecular formula C25H28N2O6S and a molecular weight of 484.57 g/mol. Its IUPAC name is [(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 3-morpholin-4-ylsulfonylbenzoate.
| Compound Name | [(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 3-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2642129 |
| Molecular Formula | C25H28N2O6S |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | [(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 3-morpholin-4-ylsulfonylbenzoate |
| SMILES | CN1/C(=C\C(=O)COC(=O)c2cccc(S(=O)(=O)N3CCOCC3)c2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C25H28N2O6S/c1-25(2)21-9-4-5-10-22(21)26(3)23(25)16-19(28)17-33-24(29)18-7-6-8-20(15-18)34(30,31)27-11-13-32-14-12-27/h4-10,15-16H,11-14,17H2,1-3H3/b23-16- |
| InChIKey | MOJRFQOLKCSWRP-KQWNVCNZSA-N |
| XLogP | 2.74 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|