C22H26N4O2S — CID 7956155
1-(3,4-dimethoxyphenyl)-3-[(Z)-[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]thiourea (PubChem CID 7956155) has the molecular formula C22H26N4O2S and a molecular weight of 410.54 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-3-[(Z)-[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]thiourea.
| Compound Name | 1-(3,4-dimethoxyphenyl)-3-[(Z)-[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]thiourea |
|---|---|
| PubChem CID | 7956155 |
| Molecular Formula | C22H26N4O2S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-3-[(Z)-[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]thiourea |
| SMILES | COc1ccc(NC(=S)N/N=C\C=C2\N(C)c3ccccc3C2(C)C)cc1OC |
| InChI | InChI=1S/C22H26N4O2S/c1-22(2)16-8-6-7-9-17(16)26(3)20(22)12-13-23-25-21(29)24-15-10-11-18(27-4)19(14-15)28-5/h6-14H,1-5H3,(H2,24,25,29)/b20-12+,23-13- |
| InChIKey | PJMGDELTAWPDHV-WUPJPBJUSA-N |
| XLogP | 4.29 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|