C25H31N3O2 — CID 3925042
2-(5-methyl-2-propan-2-ylphenoxy)-N-[2-(1,3,3-trimethylindol-2-ylidene)ethylideneamino]acetamide (PubChem CID 3925042) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is 2-(5-methyl-2-propan-2-ylphenoxy)-N-[2-(1,3,3-trimethylindol-2-ylidene)ethylideneamino]acetamide.
| Compound Name | 2-(5-methyl-2-propan-2-ylphenoxy)-N-[2-(1,3,3-trimethylindol-2-ylidene)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 3925042 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | 2-(5-methyl-2-propan-2-ylphenoxy)-N-[2-(1,3,3-trimethylindol-2-ylidene)ethylideneamino]acetamide |
| SMILES | Cc1ccc(C(C)C)c(OCC(=O)NN=CC=C2N(C)c3ccccc3C2(C)C)c1 |
| InChI | InChI=1S/C25H31N3O2/c1-17(2)19-12-11-18(3)15-22(19)30-16-24(29)27-26-14-13-23-25(4,5)20-9-7-8-10-21(20)28(23)6/h7-15,17H,16H2,1-6H3,(H,27,29) |
| InChIKey | BQQQHKCMQUPPMS-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|