C26H29N3O3 — CID 2417787
(Z,4E)-2-cyano-N-[2-(3,4-dimethoxyphenyl)ethyl]-4-(1,3,3-trimethylindol-2-ylidene)but-2-enamide (PubChem CID 2417787) has the molecular formula C26H29N3O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is (Z,4E)-2-cyano-N-[2-(3,4-dimethoxyphenyl)ethyl]-4-(1,3,3-trimethylindol-2-ylidene)but-2-enamide.
| Compound Name | (Z,4E)-2-cyano-N-[2-(3,4-dimethoxyphenyl)ethyl]-4-(1,3,3-trimethylindol-2-ylidene)but-2-enamide |
|---|---|
| PubChem CID | 2417787 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | (Z,4E)-2-cyano-N-[2-(3,4-dimethoxyphenyl)ethyl]-4-(1,3,3-trimethylindol-2-ylidene)but-2-enamide |
| SMILES | COc1ccc(CCNC(=O)/C(C#N)=C\C=C2\N(C)c3ccccc3C2(C)C)cc1OC |
| InChI | InChI=1S/C26H29N3O3/c1-26(2)20-8-6-7-9-21(20)29(3)24(26)13-11-19(17-27)25(30)28-15-14-18-10-12-22(31-4)23(16-18)32-5/h6-13,16H,14-15H2,1-5H3,(H,28,30)/b19-11-,24-13+ |
| InChIKey | QFDIBXMDESCTQG-GPMCLPINSA-N |
| XLogP | 4.12 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|