C18H20N2O2 — CID 9300451
ethyl (E,4Z)-2-cyano-4-(1,3,3-trimethylindol-2-ylidene)but-2-enoate (PubChem CID 9300451) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is ethyl (E,4Z)-2-cyano-4-(1,3,3-trimethylindol-2-ylidene)but-2-enoate.
| Compound Name | ethyl (E,4Z)-2-cyano-4-(1,3,3-trimethylindol-2-ylidene)but-2-enoate |
|---|---|
| PubChem CID | 9300451 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | ethyl (E,4Z)-2-cyano-4-(1,3,3-trimethylindol-2-ylidene)but-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/C=C1\N(C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C18H20N2O2/c1-5-22-17(21)13(12-19)10-11-16-18(2,3)14-8-6-7-9-15(14)20(16)4/h6-11H,5H2,1-4H3/b13-10+,16-11- |
| InChIKey | QNLFEPXZQOHSFQ-VKDWSQHSSA-N |
| XLogP | 3.31 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|