C19H22N2O3 — CID 7480683
2-methoxyethyl (E,4E)-2-cyano-4-(1,3,3-trimethylindol-2-ylidene)but-2-enoate (PubChem CID 7480683) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is 2-methoxyethyl (E,4E)-2-cyano-4-(1,3,3-trimethylindol-2-ylidene)but-2-enoate.
| Compound Name | 2-methoxyethyl (E,4E)-2-cyano-4-(1,3,3-trimethylindol-2-ylidene)but-2-enoate |
|---|---|
| PubChem CID | 7480683 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 2-methoxyethyl (E,4E)-2-cyano-4-(1,3,3-trimethylindol-2-ylidene)but-2-enoate |
| SMILES | COCCOC(=O)/C(C#N)=C/C=C1/N(C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C19H22N2O3/c1-19(2)15-7-5-6-8-16(15)21(3)17(19)10-9-14(13-20)18(22)24-12-11-23-4/h5-10H,11-12H2,1-4H3/b14-9+,17-10+ |
| InChIKey | FHGMBIKIFATMQP-QWGLIZDWSA-N |
| XLogP | 2.94 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|