C28H30N3O2+ — CID 135295731
methyl (2Z)-2-[(Z)-3-cyano-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]-1,3,3-trimethylindole-6-carboxylate (PubChem CID 135295731) has the molecular formula C28H30N3O2+ and a molecular weight of 440.57 g/mol. Its IUPAC name is methyl (2Z)-2-[(Z)-3-cyano-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]-1,3,3-trimethylindole-6-carboxylate.
| Compound Name | methyl (2Z)-2-[(Z)-3-cyano-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]-1,3,3-trimethylindole-6-carboxylate |
|---|---|
| PubChem CID | 135295731 |
| Molecular Formula | C28H30N3O2+ |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | methyl (2Z)-2-[(Z)-3-cyano-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]-1,3,3-trimethylindole-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)N(C)/C(=C\C=C(/C#N)C1=[N+](C)c3ccccc3C1(C)C)C2(C)C |
| InChI | InChI=1S/C28H30N3O2/c1-27(2)21-14-12-18(26(32)33-7)16-23(21)30(5)24(27)15-13-19(17-29)25-28(3,4)20-10-8-9-11-22(20)31(25)6/h8-16H,1-7H3/q+1 |
| InChIKey | RDFCVLMMMNGOGQ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 56.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|