C27H31N2O2+ — CID 3399589
methyl 1,3,3-trimethyl-2-[3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indole-5-carboxylate (PubChem CID 3399589) has the molecular formula C27H31N2O2+ and a molecular weight of 415.56 g/mol. Its IUPAC name is methyl 1,3,3-trimethyl-2-[3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indole-5-carboxylate.
| Compound Name | methyl 1,3,3-trimethyl-2-[3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indole-5-carboxylate |
|---|---|
| PubChem CID | 3399589 |
| Molecular Formula | C27H31N2O2+ |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | methyl 1,3,3-trimethyl-2-[3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indole-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)C(C)(C)C(=CC=CC1=[N+](C)c3ccccc3C1(C)C)N2C |
| InChI | InChI=1S/C27H31N2O2/c1-26(2)19-11-8-9-12-21(19)28(5)23(26)13-10-14-24-27(3,4)20-17-18(25(30)31-7)15-16-22(20)29(24)6/h8-17H,1-7H3/q+1 |
| InChIKey | NOUHBDDRBCPUFS-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 32.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|