C29H31F2N2+ — CID 56995978
5-fluoro-2-[7-(5-fluoro-1,3,3-trimethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]-1,3,3-trimethylindole (PubChem CID 56995978) has the molecular formula C29H31F2N2+ and a molecular weight of 445.58 g/mol. Its IUPAC name is 5-fluoro-2-[7-(5-fluoro-1,3,3-trimethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]-1,3,3-trimethylindole.
| Compound Name | 5-fluoro-2-[7-(5-fluoro-1,3,3-trimethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]-1,3,3-trimethylindole |
|---|---|
| PubChem CID | 56995978 |
| Molecular Formula | C29H31F2N2+ |
| Molecular Weight | 445.58 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | 5-fluoro-2-[7-(5-fluoro-1,3,3-trimethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]-1,3,3-trimethylindole |
| SMILES | CN1C(=CC=CC=CC=CC2=[N+](C)c3ccc(F)cc3C2(C)C)C(C)(C)c2cc(F)ccc21 |
| InChI | InChI=1S/C29H31F2N2/c1-28(2)22-18-20(30)14-16-24(22)32(5)26(28)12-10-8-7-9-11-13-27-29(3,4)23-19-21(31)15-17-25(23)33(27)6/h7-19H,1-6H3/q+1 |
| InChIKey | RATLVXOLIQVGNC-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.58 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|