C27H33N2O2+ — CID 59104671
[2-[3-(5-methoxy-1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]-1,3,3-trimethylindol-5-yl]methanol (PubChem CID 59104671) has the molecular formula C27H33N2O2+ and a molecular weight of 417.57 g/mol. Its IUPAC name is [2-[3-(5-methoxy-1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]-1,3,3-trimethylindol-5-yl]methanol.
| Compound Name | [2-[3-(5-methoxy-1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]-1,3,3-trimethylindol-5-yl]methanol |
|---|---|
| PubChem CID | 59104671 |
| Molecular Formula | C27H33N2O2+ |
| Molecular Weight | 417.57 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | [2-[3-(5-methoxy-1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]-1,3,3-trimethylindol-5-yl]methanol |
| SMILES | COc1ccc2c(c1)C(C)(C)C(C=CC=C1N(C)c3ccc(CO)cc3C1(C)C)=[N+]2C |
| InChI | InChI=1S/C27H33N2O2/c1-26(2)20-15-18(17-30)11-13-22(20)28(5)24(26)9-8-10-25-27(3,4)21-16-19(31-7)12-14-23(21)29(25)6/h8-16,30H,17H2,1-7H3/q+1 |
| InChIKey | CRWJWTZEKFDHEU-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 35.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.57 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|