C29H34ClN2O2+ — CID 122534571
(2E)-2-[(2Z,4E)-3-chloro-5-(5-methoxy-1,3,3-trimethylindol-1-ium-2-yl)penta-2,4-dienylidene]-5-methoxy-1,3,3-trimethylindole (PubChem CID 122534571) has the molecular formula C29H34ClN2O2+ and a molecular weight of 478.06 g/mol. Its IUPAC name is (2E)-2-[(2Z,4E)-3-chloro-5-(5-methoxy-1,3,3-trimethylindol-1-ium-2-yl)penta-2,4-dienylidene]-5-methoxy-1,3,3-trimethylindole.
| Compound Name | (2E)-2-[(2Z,4E)-3-chloro-5-(5-methoxy-1,3,3-trimethylindol-1-ium-2-yl)penta-2,4-dienylidene]-5-methoxy-1,3,3-trimethylindole |
|---|---|
| PubChem CID | 122534571 |
| Molecular Formula | C29H34ClN2O2+ |
| Molecular Weight | 478.06 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | (2E)-2-[(2Z,4E)-3-chloro-5-(5-methoxy-1,3,3-trimethylindol-1-ium-2-yl)penta-2,4-dienylidene]-5-methoxy-1,3,3-trimethylindole |
| SMILES | COc1ccc2c(c1)C(C)(C)C(/C=C/C(Cl)=C/C=C1/N(C)c3ccc(OC)cc3C1(C)C)=[N+]2C |
| InChI | InChI=1S/C29H34ClN2O2/c1-28(2)22-17-20(33-7)11-13-24(22)31(5)26(28)15-9-19(30)10-16-27-29(3,4)23-18-21(34-8)12-14-25(23)32(27)6/h9-18H,1-8H3/q+1 |
| InChIKey | QXVSKFQEIZJWHY-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 24.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.06 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|