C54H59BN2O2 — CID 10350276
(2E)-5-methoxy-2-[(E)-3-(5-methoxy-1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]-1,3,3-trimethylindole;tris(4-methylphenyl)-phenylboranuide (PubChem CID 10350276) has the molecular formula C54H59BN2O2 and a molecular weight of 778.89 g/mol. Its IUPAC name is (2E)-5-methoxy-2-[(E)-3-(5-methoxy-1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]-1,3,3-trimethylindole;tris(4-methylphenyl)-phenylboranuide.
| Compound Name | (2E)-5-methoxy-2-[(E)-3-(5-methoxy-1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]-1,3,3-trimethylindole;tris(4-methylphenyl)-phenylboranuide |
|---|---|
| PubChem CID | 10350276 |
| Molecular Formula | C54H59BN2O2 |
| Molecular Weight | 778.89 g/mol |
| Exact Mass | 778.47 |
| IUPAC Name | (2E)-5-methoxy-2-[(E)-3-(5-methoxy-1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]-1,3,3-trimethylindole;tris(4-methylphenyl)-phenylboranuide |
| SMILES | COc1ccc2c(c1)C(C)(C)C(/C=C/C=C1/N(C)c3ccc(OC)cc3C1(C)C)=[N+]2C.Cc1ccc([B-](c2ccccc2)(c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C27H26B.C27H33N2O2/c1-21-9-15-25(16-10-21)28(24-7-5-4-6-8-24,26-17-11-22(2)12-18-26)27-19-13-23(3)14-20-27;1-26(2)20-16-18(30-7)12-14-22(20)28(5)24(26)10-9-11-25-27(3,4)21-17-19(31-8)13-15-23(21)29(25)6/h4-20H,1-3H3;9-17H,1-8H3/q-1;+1 |
| InChIKey | IFQSHBLCJBAMJL-UHFFFAOYSA-N |
| XLogP | 9.57 |
| TPSA | 24.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.89 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|