C52H55BN2O2 — CID 10259510
(2E)-5-methoxy-2-[(E)-3-(5-methoxy-1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]-1,3,3-trimethylindole;(2-methylphenyl)-triphenylboranuide (PubChem CID 10259510) has the molecular formula C52H55BN2O2 and a molecular weight of 750.84 g/mol. Its IUPAC name is (2E)-5-methoxy-2-[(E)-3-(5-methoxy-1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]-1,3,3-trimethylindole;(2-methylphenyl)-triphenylboranuide.
| Compound Name | (2E)-5-methoxy-2-[(E)-3-(5-methoxy-1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]-1,3,3-trimethylindole;(2-methylphenyl)-triphenylboranuide |
|---|---|
| PubChem CID | 10259510 |
| Molecular Formula | C52H55BN2O2 |
| Molecular Weight | 750.84 g/mol |
| Exact Mass | 750.44 |
| IUPAC Name | (2E)-5-methoxy-2-[(E)-3-(5-methoxy-1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]-1,3,3-trimethylindole;(2-methylphenyl)-triphenylboranuide |
| SMILES | COc1ccc2c(c1)C(C)(C)C(/C=C/C=C1/N(C)c3ccc(OC)cc3C1(C)C)=[N+]2C.Cc1ccccc1[B-](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H33N2O2.C25H22B/c1-26(2)20-16-18(30-7)12-14-22(20)28(5)24(26)10-9-11-25-27(3,4)21-17-19(31-8)13-15-23(21)29(25)6;1-21-13-11-12-20-25(21)26(22-14-5-2-6-15-22,23-16-7-3-8-17-23)24-18-9-4-10-19-24/h9-17H,1-8H3;2-20H,1H3/q+1;-1 |
| InChIKey | KEHAQXXYKYLIQB-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 24.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.84 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|