C29H37N2O+ — CID 177452623
(2E)-1-butyl-5-methoxy-3,3-dimethyl-2-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indole (PubChem CID 177452623) has the molecular formula C29H37N2O+ and a molecular weight of 429.63 g/mol. Its IUPAC name is (2E)-1-butyl-5-methoxy-3,3-dimethyl-2-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indole.
| Compound Name | (2E)-1-butyl-5-methoxy-3,3-dimethyl-2-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indole |
|---|---|
| PubChem CID | 177452623 |
| Molecular Formula | C29H37N2O+ |
| Molecular Weight | 429.63 g/mol |
| Exact Mass | 429.29 |
| IUPAC Name | (2E)-1-butyl-5-methoxy-3,3-dimethyl-2-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indole |
| SMILES | CCCCN1/C(=C/C=C/C2=[N+](C)c3ccccc3C2(C)C)C(C)(C)c2cc(OC)ccc21 |
| InChI | InChI=1S/C29H37N2O/c1-8-9-19-31-25-18-17-21(32-7)20-23(25)29(4,5)27(31)16-12-15-26-28(2,3)22-13-10-11-14-24(22)30(26)6/h10-18,20H,8-9,19H2,1-7H3/q+1 |
| InChIKey | KIXFOANNEHUMJW-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 15.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.63 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|