C44H49N2+ — CID 91016408
3-butyl-1,1-dimethyl-2-[3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]benzo[e]indole;1,5-dimethylnaphthalene (PubChem CID 91016408) has the molecular formula C44H49N2+ and a molecular weight of 605.89 g/mol. Its IUPAC name is 3-butyl-1,1-dimethyl-2-[3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]benzo[e]indole;1,5-dimethylnaphthalene.
| Compound Name | 3-butyl-1,1-dimethyl-2-[3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]benzo[e]indole;1,5-dimethylnaphthalene |
|---|---|
| PubChem CID | 91016408 |
| Molecular Formula | C44H49N2+ |
| Molecular Weight | 605.89 g/mol |
| Exact Mass | 605.39 |
| IUPAC Name | 3-butyl-1,1-dimethyl-2-[3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]benzo[e]indole;1,5-dimethylnaphthalene |
| SMILES | CCCCN1C(=CC=CC2=[N+](C)c3ccccc3C2(C)C)C(C)(C)c2c1ccc1ccccc21.Cc1cccc2c(C)cccc12 |
| InChI | InChI=1S/C32H37N2.C12H12/c1-7-8-22-34-27-21-20-23-14-9-10-15-24(23)30(27)32(4,5)29(34)19-13-18-28-31(2,3)25-16-11-12-17-26(25)33(28)6;1-9-5-3-8-12-10(2)6-4-7-11(9)12/h9-21H,7-8,22H2,1-6H3;3-8H,1-2H3/q+1; |
| InChIKey | KJIGZFFIYXDESZ-UHFFFAOYSA-N |
| XLogP | 11.34 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.89 |
| LogP ≤ 5 | 11.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|