C39H43N2O+ — CID 156714527
7-[(2E)-1,1-dimethyl-2-[(E)-3-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)prop-2-enylidene]benzo[e]indol-3-yl]heptan-2-one (PubChem CID 156714527) has the molecular formula C39H43N2O+ and a molecular weight of 555.79 g/mol. Its IUPAC name is 7-[(2E)-1,1-dimethyl-2-[(E)-3-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)prop-2-enylidene]benzo[e]indol-3-yl]heptan-2-one.
| Compound Name | 7-[(2E)-1,1-dimethyl-2-[(E)-3-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)prop-2-enylidene]benzo[e]indol-3-yl]heptan-2-one |
|---|---|
| PubChem CID | 156714527 |
| Molecular Formula | C39H43N2O+ |
| Molecular Weight | 555.79 g/mol |
| Exact Mass | 555.34 |
| IUPAC Name | 7-[(2E)-1,1-dimethyl-2-[(E)-3-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)prop-2-enylidene]benzo[e]indol-3-yl]heptan-2-one |
| SMILES | CC(=O)CCCCCN1/C(=C/C=C/C2=[N+](C)c3ccc4ccccc4c3C2(C)C)C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C39H43N2O/c1-27(42)15-8-7-13-26-41-33-25-23-29-17-10-12-19-31(29)37(33)39(4,5)35(41)21-14-20-34-38(2,3)36-30-18-11-9-16-28(30)22-24-32(36)40(34)6/h9-12,14,16-25H,7-8,13,15,26H2,1-6H3/q+1 |
| InChIKey | ZZZSXNHFFADSPA-UHFFFAOYSA-N |
| XLogP | 9.39 |
| TPSA | 23.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.79 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|