C42H44N3O4+ — CID 171028830
(2,5-dioxopyrrolidin-1-yl) 6-[(2E)-1,1-dimethyl-2-[(Z)-3-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)prop-2-enylidene]benzo[e]indol-3-yl]hexanoate (PubChem CID 171028830) has the molecular formula C42H44N3O4+ and a molecular weight of 654.83 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-[(2E)-1,1-dimethyl-2-[(Z)-3-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)prop-2-enylidene]benzo[e]indol-3-yl]hexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-[(2E)-1,1-dimethyl-2-[(Z)-3-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)prop-2-enylidene]benzo[e]indol-3-yl]hexanoate |
|---|---|
| PubChem CID | 171028830 |
| Molecular Formula | C42H44N3O4+ |
| Molecular Weight | 654.83 g/mol |
| Exact Mass | 654.33 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-[(2E)-1,1-dimethyl-2-[(Z)-3-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)prop-2-enylidene]benzo[e]indol-3-yl]hexanoate |
| SMILES | C[N+]1=C(/C=C\C=C2\N(CCCCCC(=O)ON3C(=O)CCC3=O)c3ccc4ccccc4c3C2(C)C)C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C42H44N3O4/c1-41(2)34(43(5)32-23-21-28-14-8-10-16-30(28)39(32)41)18-13-19-35-42(3,4)40-31-17-11-9-15-29(31)22-24-33(40)44(35)27-12-6-7-20-38(48)49-45-36(46)25-26-37(45)47/h8-11,13-19,21-24H,6-7,12,20,25-27H2,1-5H3/q+1 |
| InChIKey | MLTQHYXPKJXNSU-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 69.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.83 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|