C40H45N4O+ — CID 165412864
6-[(2Z)-1,1-dimethyl-2-[(2E,4E)-5-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)penta-2,4-dienylidene]benzo[e]indol-3-yl]hexanehydrazide (PubChem CID 165412864) has the molecular formula C40H45N4O+ and a molecular weight of 597.83 g/mol. Its IUPAC name is 6-[(2Z)-1,1-dimethyl-2-[(2E,4E)-5-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)penta-2,4-dienylidene]benzo[e]indol-3-yl]hexanehydrazide.
| Compound Name | 6-[(2Z)-1,1-dimethyl-2-[(2E,4E)-5-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)penta-2,4-dienylidene]benzo[e]indol-3-yl]hexanehydrazide |
|---|---|
| PubChem CID | 165412864 |
| Molecular Formula | C40H45N4O+ |
| Molecular Weight | 597.83 g/mol |
| Exact Mass | 597.36 |
| IUPAC Name | 6-[(2Z)-1,1-dimethyl-2-[(2E,4E)-5-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)penta-2,4-dienylidene]benzo[e]indol-3-yl]hexanehydrazide |
| SMILES | C[N+]1=C(/C=C/C=C/C=C2\N(CCCCCC(=O)NN)c3ccc4ccccc4c3C2(C)C)C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C40H44N4O/c1-39(2)34(43(5)32-25-23-28-16-11-13-18-30(28)37(32)39)20-8-6-9-21-35-40(3,4)38-31-19-14-12-17-29(31)24-26-33(38)44(35)27-15-7-10-22-36(45)42-41/h6,8-9,11-14,16-21,23-26H,7,10,15,22,27,41H2,1-5H3/p+1 |
| InChIKey | DOSATGHREPSLQB-UHFFFAOYSA-O |
| XLogP | 8.34 |
| TPSA | 61.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.83 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|