C45H55N3+2 — CID 176763228
6-[(2E)-1,1-dimethyl-2-[(2E,4E,6E)-7-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)hepta-2,4,6-trienylidene]benzo[e]indol-3-yl]hexyl-trimethylazanium (PubChem CID 176763228) has the molecular formula C45H55N3+2 and a molecular weight of 637.96 g/mol. Its IUPAC name is 6-[(2E)-1,1-dimethyl-2-[(2E,4E,6E)-7-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)hepta-2,4,6-trienylidene]benzo[e]indol-3-yl]hexyl-trimethylazanium.
| Compound Name | 6-[(2E)-1,1-dimethyl-2-[(2E,4E,6E)-7-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)hepta-2,4,6-trienylidene]benzo[e]indol-3-yl]hexyl-trimethylazanium |
|---|---|
| PubChem CID | 176763228 |
| Molecular Formula | C45H55N3+2 |
| Molecular Weight | 637.96 g/mol |
| Exact Mass | 637.44 |
| IUPAC Name | 6-[(2E)-1,1-dimethyl-2-[(2E,4E,6E)-7-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)hepta-2,4,6-trienylidene]benzo[e]indol-3-yl]hexyl-trimethylazanium |
| SMILES | C[N+]1=C(/C=C/C=C/C=C/C=C2/N(CCCCCC[N+](C)(C)C)c3ccc4ccccc4c3C2(C)C)C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C45H55N3/c1-44(2)40(46(5)38-30-28-34-22-16-18-24-36(34)42(38)44)26-14-10-9-11-15-27-41-45(3,4)43-37-25-19-17-23-35(37)29-31-39(43)47(41)32-20-12-13-21-33-48(6,7)8/h9-11,14-19,22-31H,12-13,20-21,32-33H2,1-8H3/q+2 |
| InChIKey | RGOKDSHXIOYNCK-UHFFFAOYSA-N |
| XLogP | 10.62 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.96 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|