C34H35N2+ — CID 20659161
2-[(E,3Z)-3-(3-ethyl-1,1-dimethylbenzo[e]indol-2-ylidene)prop-1-enyl]-1,1,3-trimethylbenzo[e]indol-3-ium (PubChem CID 20659161) has the molecular formula C34H35N2+ and a molecular weight of 471.67 g/mol. Its IUPAC name is 2-[(E,3Z)-3-(3-ethyl-1,1-dimethylbenzo[e]indol-2-ylidene)prop-1-enyl]-1,1,3-trimethylbenzo[e]indol-3-ium.
| Compound Name | 2-[(E,3Z)-3-(3-ethyl-1,1-dimethylbenzo[e]indol-2-ylidene)prop-1-enyl]-1,1,3-trimethylbenzo[e]indol-3-ium |
|---|---|
| PubChem CID | 20659161 |
| Molecular Formula | C34H35N2+ |
| Molecular Weight | 471.67 g/mol |
| Exact Mass | 471.28 |
| IUPAC Name | 2-[(E,3Z)-3-(3-ethyl-1,1-dimethylbenzo[e]indol-2-ylidene)prop-1-enyl]-1,1,3-trimethylbenzo[e]indol-3-ium |
| SMILES | CCN1/C(=C\C=C\C2=[N+](C)c3ccc4ccccc4c3C2(C)C)C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C34H35N2/c1-7-36-28-22-20-24-14-9-11-16-26(24)32(28)34(4,5)30(36)18-12-17-29-33(2,3)31-25-15-10-8-13-23(25)19-21-27(31)35(29)6/h8-22H,7H2,1-6H3/q+1 |
| InChIKey | NDLRYVUZIHYQHX-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.67 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|