C36H35N2O+ — CID 139526451
1-[(2E)-1,1-dimethyl-2-[(2E,4E)-5-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)penta-2,4-dienylidene]benzo[e]indol-3-yl]ethanone (PubChem CID 139526451) has the molecular formula C36H35N2O+ and a molecular weight of 511.69 g/mol. Its IUPAC name is 1-[(2E)-1,1-dimethyl-2-[(2E,4E)-5-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)penta-2,4-dienylidene]benzo[e]indol-3-yl]ethanone.
| Compound Name | 1-[(2E)-1,1-dimethyl-2-[(2E,4E)-5-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)penta-2,4-dienylidene]benzo[e]indol-3-yl]ethanone |
|---|---|
| PubChem CID | 139526451 |
| Molecular Formula | C36H35N2O+ |
| Molecular Weight | 511.69 g/mol |
| Exact Mass | 511.27 |
| IUPAC Name | 1-[(2E)-1,1-dimethyl-2-[(2E,4E)-5-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)penta-2,4-dienylidene]benzo[e]indol-3-yl]ethanone |
| SMILES | CC(=O)N1/C(=C/C=C/C=C/C2=[N+](C)c3ccc4ccccc4c3C2(C)C)C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C36H35N2O/c1-24(39)38-30-23-21-26-15-11-13-17-28(26)34(30)36(4,5)32(38)19-9-7-8-18-31-35(2,3)33-27-16-12-10-14-25(27)20-22-29(33)37(31)6/h7-23H,1-6H3/q+1 |
| InChIKey | VEMIUTKDZWADMR-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 23.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.69 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|