C44H51N2O+ — CID 164708334
8-[(2E)-1,1-dimethyl-2-[(2E,4E)-5-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)penta-2,4-dienylidene]benzo[e]indol-3-yl]-2,2-dimethyloctan-3-one (PubChem CID 164708334) has the molecular formula C44H51N2O+ and a molecular weight of 623.91 g/mol. Its IUPAC name is 8-[(2E)-1,1-dimethyl-2-[(2E,4E)-5-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)penta-2,4-dienylidene]benzo[e]indol-3-yl]-2,2-dimethyloctan-3-one.
| Compound Name | 8-[(2E)-1,1-dimethyl-2-[(2E,4E)-5-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)penta-2,4-dienylidene]benzo[e]indol-3-yl]-2,2-dimethyloctan-3-one |
|---|---|
| PubChem CID | 164708334 |
| Molecular Formula | C44H51N2O+ |
| Molecular Weight | 623.91 g/mol |
| Exact Mass | 623.40 |
| IUPAC Name | 8-[(2E)-1,1-dimethyl-2-[(2E,4E)-5-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)penta-2,4-dienylidene]benzo[e]indol-3-yl]-2,2-dimethyloctan-3-one |
| SMILES | C[N+]1=C(/C=C/C=C/C=C2/N(CCCCCC(=O)C(C)(C)C)c3ccc4ccccc4c3C2(C)C)C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C44H51N2O/c1-42(2,3)39(47)25-13-10-18-30-46-36-29-27-32-20-15-17-22-34(32)41(36)44(6,7)38(46)24-12-9-11-23-37-43(4,5)40-33-21-16-14-19-31(33)26-28-35(40)45(37)8/h9,11-12,14-17,19-24,26-29H,10,13,18,25,30H2,1-8H3/q+1 |
| InChIKey | SDZHKLIUJDICHZ-UHFFFAOYSA-N |
| XLogP | 10.97 |
| TPSA | 23.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.91 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|