C44H53N2+ — CID 154658336
(2E)-1,1-dimethyl-3-(6-methylhept-6-enyl)-2-[(2E,4E)-5-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)penta-2,4-dienylidene]benzo[e]indole;ethane (PubChem CID 154658336) has the molecular formula C44H53N2+ and a molecular weight of 609.92 g/mol. Its IUPAC name is (2E)-1,1-dimethyl-3-(6-methylhept-6-enyl)-2-[(2E,4E)-5-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)penta-2,4-dienylidene]benzo[e]indole;ethane.
| Compound Name | (2E)-1,1-dimethyl-3-(6-methylhept-6-enyl)-2-[(2E,4E)-5-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)penta-2,4-dienylidene]benzo[e]indole;ethane |
|---|---|
| PubChem CID | 154658336 |
| Molecular Formula | C44H53N2+ |
| Molecular Weight | 609.92 g/mol |
| Exact Mass | 609.42 |
| IUPAC Name | (2E)-1,1-dimethyl-3-(6-methylhept-6-enyl)-2-[(2E,4E)-5-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)penta-2,4-dienylidene]benzo[e]indole;ethane |
| SMILES | C=C(C)CCCCCN1/C(=C/C=C/C=C/C2=[N+](C)c3ccc4ccccc4c3C2(C)C)C(C)(C)c2c1ccc1ccccc21.CC |
| InChI | InChI=1S/C42H47N2.C2H6/c1-30(2)18-10-9-17-29-44-36-28-26-32-20-14-16-22-34(32)40(36)42(5,6)38(44)24-12-8-11-23-37-41(3,4)39-33-21-15-13-19-31(33)25-27-35(39)43(37)7;1-2/h8,11-16,19-28H,1,9-10,17-18,29H2,2-7H3;1-2H3/q+1; |
| InChIKey | SLPHYWGWNGITGB-UHFFFAOYSA-N |
| XLogP | 11.96 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.92 |
| LogP ≤ 5 | 11.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|