C43H53N2+ — CID 171840911
(2E)-1,1-dimethyl-3-propyl-2-[(2E,4E,6E)-7-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)hepta-2,4,6-trienylidene]benzo[e]indole;ethane (PubChem CID 171840911) has the molecular formula C43H53N2+ and a molecular weight of 597.91 g/mol. Its IUPAC name is (2E)-1,1-dimethyl-3-propyl-2-[(2E,4E,6E)-7-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)hepta-2,4,6-trienylidene]benzo[e]indole;ethane.
| Compound Name | (2E)-1,1-dimethyl-3-propyl-2-[(2E,4E,6E)-7-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)hepta-2,4,6-trienylidene]benzo[e]indole;ethane |
|---|---|
| PubChem CID | 171840911 |
| Molecular Formula | C43H53N2+ |
| Molecular Weight | 597.91 g/mol |
| Exact Mass | 597.42 |
| IUPAC Name | (2E)-1,1-dimethyl-3-propyl-2-[(2E,4E,6E)-7-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)hepta-2,4,6-trienylidene]benzo[e]indole;ethane |
| SMILES | CC.CC.CCCN1/C(=C/C=C/C=C/C=C/C2=[N+](C)c3ccc4ccccc4c3C2(C)C)C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C39H41N2.2C2H6/c1-7-27-41-33-26-24-29-18-14-16-20-31(29)37(33)39(4,5)35(41)22-12-10-8-9-11-21-34-38(2,3)36-30-19-15-13-17-28(30)23-25-32(36)40(34)6;2*1-2/h8-26H,7,27H2,1-6H3;2*1-2H3/q+1;; |
| InChIKey | ZVBWWCWTTXOGRF-UHFFFAOYSA-N |
| XLogP | 11.81 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.91 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|