C39H41N2O+ — CID 159334446
1-[1,1-dimethyl-2-[5-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)penta-2,4-dienylidene]benzo[e]indol-3-yl]-2,2-dimethylpropan-1-one (PubChem CID 159334446) has the molecular formula C39H41N2O+ and a molecular weight of 553.77 g/mol. Its IUPAC name is 1-[1,1-dimethyl-2-[5-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)penta-2,4-dienylidene]benzo[e]indol-3-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[1,1-dimethyl-2-[5-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)penta-2,4-dienylidene]benzo[e]indol-3-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 159334446 |
| Molecular Formula | C39H41N2O+ |
| Molecular Weight | 553.77 g/mol |
| Exact Mass | 553.32 |
| IUPAC Name | 1-[1,1-dimethyl-2-[5-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)penta-2,4-dienylidene]benzo[e]indol-3-yl]-2,2-dimethylpropan-1-one |
| SMILES | C[N+]1=C(C=CC=CC=C2N(C(=O)C(C)(C)C)c3ccc4ccccc4c3C2(C)C)C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C39H41N2O/c1-37(2,3)36(42)41-31-25-23-27-17-13-15-19-29(27)35(31)39(6,7)33(41)21-11-9-10-20-32-38(4,5)34-28-18-14-12-16-26(28)22-24-30(34)40(32)8/h9-25H,1-8H3/q+1 |
| InChIKey | LFIUUGUOTROXIG-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 23.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.77 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|