C50H63N2O4+ — CID 54674346
10-[2-[(E,3Z)-3-[3-(8-carboxyoctyl)-1,1-dimethylbenzo[e]indol-2-ylidene]prop-1-enyl]-1,1-dimethylbenzo[e]indol-3-ium-3-yl]decanoic acid (PubChem CID 54674346) has the molecular formula C50H63N2O4+ and a molecular weight of 756.06 g/mol. Its IUPAC name is 10-[2-[(E,3Z)-3-[3-(8-carboxyoctyl)-1,1-dimethylbenzo[e]indol-2-ylidene]prop-1-enyl]-1,1-dimethylbenzo[e]indol-3-ium-3-yl]decanoic acid.
| Compound Name | 10-[2-[(E,3Z)-3-[3-(8-carboxyoctyl)-1,1-dimethylbenzo[e]indol-2-ylidene]prop-1-enyl]-1,1-dimethylbenzo[e]indol-3-ium-3-yl]decanoic acid |
|---|---|
| PubChem CID | 54674346 |
| Molecular Formula | C50H63N2O4+ |
| Molecular Weight | 756.06 g/mol |
| Exact Mass | 755.48 |
| IUPAC Name | 10-[2-[(E,3Z)-3-[3-(8-carboxyoctyl)-1,1-dimethylbenzo[e]indol-2-ylidene]prop-1-enyl]-1,1-dimethylbenzo[e]indol-3-ium-3-yl]decanoic acid |
| SMILES | CC1(C)C(/C=C/C=C2\N(CCCCCCCCC(=O)O)c3ccc4ccccc4c3C2(C)C)=[N+](CCCCCCCCCC(=O)O)c2ccc3ccccc3c21 |
| InChI | InChI=1S/C50H62N2O4/c1-49(2)43(51(35-20-12-8-5-6-10-14-29-45(53)54)41-33-31-37-23-16-18-25-39(37)47(41)49)27-22-28-44-50(3,4)48-40-26-19-17-24-38(40)32-34-42(48)52(44)36-21-13-9-7-11-15-30-46(55)56/h16-19,22-28,31-34H,5-15,20-21,29-30,35-36H2,1-4H3,(H-,53,54,55,56)/p+1 |
| InChIKey | XERGGFBQIRKOBR-UHFFFAOYSA-O |
| XLogP | 12.63 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.06 |
| LogP ≤ 5 | 12.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|