C37H37N2O4+ — CID 54674344
3-[(2Z)-2-[(E)-3-[3-(2-carboxyethyl)-1,1-dimethylbenzo[e]indol-3-ium-2-yl]prop-2-enylidene]-1,1-dimethylbenzo[e]indol-3-yl]propanoic acid (PubChem CID 54674344) has the molecular formula C37H37N2O4+ and a molecular weight of 573.71 g/mol. Its IUPAC name is 3-[(2Z)-2-[(E)-3-[3-(2-carboxyethyl)-1,1-dimethylbenzo[e]indol-3-ium-2-yl]prop-2-enylidene]-1,1-dimethylbenzo[e]indol-3-yl]propanoic acid.
| Compound Name | 3-[(2Z)-2-[(E)-3-[3-(2-carboxyethyl)-1,1-dimethylbenzo[e]indol-3-ium-2-yl]prop-2-enylidene]-1,1-dimethylbenzo[e]indol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 54674344 |
| Molecular Formula | C37H37N2O4+ |
| Molecular Weight | 573.71 g/mol |
| Exact Mass | 573.27 |
| IUPAC Name | 3-[(2Z)-2-[(E)-3-[3-(2-carboxyethyl)-1,1-dimethylbenzo[e]indol-3-ium-2-yl]prop-2-enylidene]-1,1-dimethylbenzo[e]indol-3-yl]propanoic acid |
| SMILES | CC1(C)C(/C=C/C=C2\N(CCC(=O)O)c3ccc4ccccc4c3C2(C)C)=[N+](CCC(=O)O)c2ccc3ccccc3c21 |
| InChI | InChI=1S/C37H36N2O4/c1-36(2)30(38(22-20-32(40)41)28-18-16-24-10-5-7-12-26(24)34(28)36)14-9-15-31-37(3,4)35-27-13-8-6-11-25(27)17-19-29(35)39(31)23-21-33(42)43/h5-19H,20-23H2,1-4H3,(H-,40,41,42,43)/p+1 |
| InChIKey | IYJAVQBAWWZWCY-UHFFFAOYSA-O |
| XLogP | 7.56 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.71 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|