C39H38N2O4 — CID 59025227
3-[2-[(1E,3E,5E)-5-[3-(2-carboxyethyl)-1,1-dimethylbenzo[e]indol-2-ylidene]penta-1,3-dienyl]-1,1-dimethylbenzo[e]indol-3-ium-3-yl]propanoate (PubChem CID 59025227) has the molecular formula C39H38N2O4 and a molecular weight of 598.74 g/mol. Its IUPAC name is 3-[2-[(1E,3E,5E)-5-[3-(2-carboxyethyl)-1,1-dimethylbenzo[e]indol-2-ylidene]penta-1,3-dienyl]-1,1-dimethylbenzo[e]indol-3-ium-3-yl]propanoate.
| Compound Name | 3-[2-[(1E,3E,5E)-5-[3-(2-carboxyethyl)-1,1-dimethylbenzo[e]indol-2-ylidene]penta-1,3-dienyl]-1,1-dimethylbenzo[e]indol-3-ium-3-yl]propanoate |
|---|---|
| PubChem CID | 59025227 |
| Molecular Formula | C39H38N2O4 |
| Molecular Weight | 598.74 g/mol |
| Exact Mass | 598.28 |
| IUPAC Name | 3-[2-[(1E,3E,5E)-5-[3-(2-carboxyethyl)-1,1-dimethylbenzo[e]indol-2-ylidene]penta-1,3-dienyl]-1,1-dimethylbenzo[e]indol-3-ium-3-yl]propanoate |
| SMILES | CC1(C)C(/C=C/C=C/C=C2/N(CCC(=O)O)c3ccc4ccccc4c3C2(C)C)=[N+](CCC(=O)[O-])c2ccc3ccccc3c21 |
| InChI | InChI=1S/C39H38N2O4/c1-38(2)32(40(24-22-34(42)43)30-20-18-26-12-8-10-14-28(26)36(30)38)16-6-5-7-17-33-39(3,4)37-29-15-11-9-13-27(29)19-21-31(37)41(33)25-23-35(44)45/h5-21H,22-25H2,1-4H3,(H-,42,43,44,45) |
| InChIKey | KYYALTIEHCRWHE-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.74 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|