C42H47N2O3+ — CID 168787185
6-[2-[(1E,3E,5E)-5-[3-(2-methoxyethyl)-1,1-dimethylbenzo[e]indol-2-ylidene]penta-1,3-dienyl]-1,1-dimethylbenzo[e]indol-3-ium-3-yl]hexanoic acid (PubChem CID 168787185) has the molecular formula C42H47N2O3+ and a molecular weight of 627.85 g/mol. Its IUPAC name is 6-[2-[(1E,3E,5E)-5-[3-(2-methoxyethyl)-1,1-dimethylbenzo[e]indol-2-ylidene]penta-1,3-dienyl]-1,1-dimethylbenzo[e]indol-3-ium-3-yl]hexanoic acid.
| Compound Name | 6-[2-[(1E,3E,5E)-5-[3-(2-methoxyethyl)-1,1-dimethylbenzo[e]indol-2-ylidene]penta-1,3-dienyl]-1,1-dimethylbenzo[e]indol-3-ium-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 168787185 |
| Molecular Formula | C42H47N2O3+ |
| Molecular Weight | 627.85 g/mol |
| Exact Mass | 627.36 |
| IUPAC Name | 6-[2-[(1E,3E,5E)-5-[3-(2-methoxyethyl)-1,1-dimethylbenzo[e]indol-2-ylidene]penta-1,3-dienyl]-1,1-dimethylbenzo[e]indol-3-ium-3-yl]hexanoic acid |
| SMILES | COCCN1/C(=C/C=C/C=C/C2=[N+](CCCCCC(=O)O)c3ccc4ccccc4c3C2(C)C)C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C42H46N2O3/c1-41(2)36(43(27-15-7-10-22-38(45)46)34-25-23-30-16-11-13-18-32(30)39(34)41)20-8-6-9-21-37-42(3,4)40-33-19-14-12-17-31(33)24-26-35(40)44(37)28-29-47-5/h6,8-9,11-14,16-21,23-26H,7,10,15,22,27-29H2,1-5H3/p+1 |
| InChIKey | TXOACFHREBFYNV-UHFFFAOYSA-O |
| XLogP | 9.45 |
| TPSA | 52.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.85 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|