C42H47N2O6S+ — CID 146762193
6-[2-[5-[3-(2-methoxyethyl)-1,1-dimethylbenzo[e]indol-2-ylidene]penta-1,3-dienyl]-1,1-dimethyl-6-sulfobenzo[e]indol-3-ium-3-yl]hexanoic acid (PubChem CID 146762193) has the molecular formula C42H47N2O6S+ and a molecular weight of 707.91 g/mol. Its IUPAC name is 6-[2-[5-[3-(2-methoxyethyl)-1,1-dimethylbenzo[e]indol-2-ylidene]penta-1,3-dienyl]-1,1-dimethyl-6-sulfobenzo[e]indol-3-ium-3-yl]hexanoic acid.
| Compound Name | 6-[2-[5-[3-(2-methoxyethyl)-1,1-dimethylbenzo[e]indol-2-ylidene]penta-1,3-dienyl]-1,1-dimethyl-6-sulfobenzo[e]indol-3-ium-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 146762193 |
| Molecular Formula | C42H47N2O6S+ |
| Molecular Weight | 707.91 g/mol |
| Exact Mass | 707.31 |
| IUPAC Name | 6-[2-[5-[3-(2-methoxyethyl)-1,1-dimethylbenzo[e]indol-2-ylidene]penta-1,3-dienyl]-1,1-dimethyl-6-sulfobenzo[e]indol-3-ium-3-yl]hexanoic acid |
| SMILES | COCCN1C(=CC=CC=CC2=[N+](CCCCCC(=O)O)c3ccc4c(S(=O)(=O)O)cccc4c3C2(C)C)C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C42H46N2O6S/c1-41(2)37(44(27-28-50-5)33-24-22-29-15-11-12-16-30(29)39(33)41)20-9-6-8-19-36-42(3,4)40-32-17-14-18-35(51(47,48)49)31(32)23-25-34(40)43(36)26-13-7-10-21-38(45)46/h6,8-9,11-12,14-20,22-25H,7,10,13,21,26-28H2,1-5H3,(H-,45,46,47,48,49)/p+1 |
| InChIKey | RPQNOQSGJGEAOW-UHFFFAOYSA-O |
| XLogP | 8.70 |
| TPSA | 107.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.91 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|