C43H49N2O11S3+ — CID 158300187
6-[2-[5-[1,1-dimethyl-3-(4-sulfobutyl)benzo[e]indol-2-ylidene]penta-1,3-dienyl]-1,1-dimethyl-6,8-disulfobenzo[e]indol-3-ium-3-yl]hexanoic acid (PubChem CID 158300187) has the molecular formula C43H49N2O11S3+ and a molecular weight of 866.07 g/mol. Its IUPAC name is 6-[2-[5-[1,1-dimethyl-3-(4-sulfobutyl)benzo[e]indol-2-ylidene]penta-1,3-dienyl]-1,1-dimethyl-6,8-disulfobenzo[e]indol-3-ium-3-yl]hexanoic acid.
| Compound Name | 6-[2-[5-[1,1-dimethyl-3-(4-sulfobutyl)benzo[e]indol-2-ylidene]penta-1,3-dienyl]-1,1-dimethyl-6,8-disulfobenzo[e]indol-3-ium-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 158300187 |
| Molecular Formula | C43H49N2O11S3+ |
| Molecular Weight | 866.07 g/mol |
| Exact Mass | 865.25 |
| IUPAC Name | 6-[2-[5-[1,1-dimethyl-3-(4-sulfobutyl)benzo[e]indol-2-ylidene]penta-1,3-dienyl]-1,1-dimethyl-6,8-disulfobenzo[e]indol-3-ium-3-yl]hexanoic acid |
| SMILES | CC1(C)C(=CC=CC=CC2=[N+](CCCCCC(=O)O)c3ccc4c(S(=O)(=O)O)cc(S(=O)(=O)O)cc4c3C2(C)C)N(CCCCS(=O)(=O)O)c2ccc3ccccc3c21 |
| InChI | InChI=1S/C43H48N2O11S3/c1-42(2)37(45(25-13-14-26-57(48,49)50)34-22-20-29-15-10-11-16-31(29)40(34)42)17-7-5-8-18-38-43(3,4)41-33-27-30(58(51,52)53)28-36(59(54,55)56)32(33)21-23-35(41)44(38)24-12-6-9-19-39(46)47/h5,7-8,10-11,15-18,20-23,27-28H,6,9,12-14,19,24-26H2,1-4H3,(H3-,46,47,48,49,50,51,52,53,54,55,56)/p+1 |
| InChIKey | HOFIYMMXIJCFSM-UHFFFAOYSA-O |
| XLogP | 7.97 |
| TPSA | 206.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.07 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|