C47H57N2O7S+ — CID 123680519
3-(6-ethoxy-6-oxohexyl)-2-[3-[3-(6-ethoxy-6-oxohexyl)-1,1-dimethylbenzo[e]indol-2-ylidene]prop-1-enyl]-1,1-dimethylbenzo[e]indol-3-ium-6-sulfonic acid (PubChem CID 123680519) has the molecular formula C47H57N2O7S+ and a molecular weight of 794.05 g/mol. Its IUPAC name is 3-(6-ethoxy-6-oxohexyl)-2-[3-[3-(6-ethoxy-6-oxohexyl)-1,1-dimethylbenzo[e]indol-2-ylidene]prop-1-enyl]-1,1-dimethylbenzo[e]indol-3-ium-6-sulfonic acid.
| Compound Name | 3-(6-ethoxy-6-oxohexyl)-2-[3-[3-(6-ethoxy-6-oxohexyl)-1,1-dimethylbenzo[e]indol-2-ylidene]prop-1-enyl]-1,1-dimethylbenzo[e]indol-3-ium-6-sulfonic acid |
|---|---|
| PubChem CID | 123680519 |
| Molecular Formula | C47H57N2O7S+ |
| Molecular Weight | 794.05 g/mol |
| Exact Mass | 793.39 |
| IUPAC Name | 3-(6-ethoxy-6-oxohexyl)-2-[3-[3-(6-ethoxy-6-oxohexyl)-1,1-dimethylbenzo[e]indol-2-ylidene]prop-1-enyl]-1,1-dimethylbenzo[e]indol-3-ium-6-sulfonic acid |
| SMILES | CCOC(=O)CCCCCN1C(=CC=CC2=[N+](CCCCCC(=O)OCC)c3ccc4c(S(=O)(=O)O)cccc4c3C2(C)C)C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C47H56N2O7S/c1-7-55-42(50)25-11-9-15-31-48-37-29-27-33-19-13-14-20-34(33)44(37)46(3,4)40(48)23-18-24-41-47(5,6)45-36-21-17-22-39(57(52,53)54)35(36)28-30-38(45)49(41)32-16-10-12-26-43(51)56-8-2/h13-14,17-24,27-30H,7-12,15-16,25-26,31-32H2,1-6H3/p+1 |
| InChIKey | FEGQRQQCTKCNKQ-UHFFFAOYSA-O |
| XLogP | 10.10 |
| TPSA | 113.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.05 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|