C51H58N5O4+ — CID 160731893
(4,6-dimethoxy-1,3,5-triazin-2-yl) 6-[2-[7-(1,1-dimethyl-3-pentylbenzo[e]indol-3-ium-2-yl)hepta-2,4,6-trienylidene]-1,1-dimethylbenzo[e]indol-3-yl]hexanoate (PubChem CID 160731893) has the molecular formula C51H58N5O4+ and a molecular weight of 805.06 g/mol. Its IUPAC name is (4,6-dimethoxy-1,3,5-triazin-2-yl) 6-[2-[7-(1,1-dimethyl-3-pentylbenzo[e]indol-3-ium-2-yl)hepta-2,4,6-trienylidene]-1,1-dimethylbenzo[e]indol-3-yl]hexanoate.
| Compound Name | (4,6-dimethoxy-1,3,5-triazin-2-yl) 6-[2-[7-(1,1-dimethyl-3-pentylbenzo[e]indol-3-ium-2-yl)hepta-2,4,6-trienylidene]-1,1-dimethylbenzo[e]indol-3-yl]hexanoate |
|---|---|
| PubChem CID | 160731893 |
| Molecular Formula | C51H58N5O4+ |
| Molecular Weight | 805.06 g/mol |
| Exact Mass | 804.45 |
| IUPAC Name | (4,6-dimethoxy-1,3,5-triazin-2-yl) 6-[2-[7-(1,1-dimethyl-3-pentylbenzo[e]indol-3-ium-2-yl)hepta-2,4,6-trienylidene]-1,1-dimethylbenzo[e]indol-3-yl]hexanoate |
| SMILES | CCCCC[N+]1=C(C=CC=CC=CC=C2N(CCCCCC(=O)Oc3nc(OC)nc(OC)n3)c3ccc4ccccc4c3C2(C)C)C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C51H58N5O4/c1-8-9-21-34-55-40-32-30-36-23-17-19-25-38(36)45(40)50(2,3)42(55)27-14-11-10-12-15-28-43-51(4,5)46-39-26-20-18-24-37(39)31-33-41(46)56(43)35-22-13-16-29-44(57)60-49-53-47(58-6)52-48(54-49)59-7/h10-12,14-15,17-20,23-28,30-33H,8-9,13,16,21-22,29,34-35H2,1-7H3/q+1 |
| InChIKey | XOXGANOTIZJSIL-UHFFFAOYSA-N |
| XLogP | 11.28 |
| TPSA | 89.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.06 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|