C50H63N2O2+ — CID 144810967
acetaldehyde;formaldehyde;(2Z)-3-hexyl-2-[(2E,4E,6E)-7-(3-hexyl-1,1-dimethylbenzo[e]indol-3-ium-2-yl)hepta-2,4,6-trienylidene]-1,1-dimethylbenzo[e]indole (PubChem CID 144810967) has the molecular formula C50H63N2O2+ and a molecular weight of 724.07 g/mol. Its IUPAC name is acetaldehyde;formaldehyde;(2Z)-3-hexyl-2-[(2E,4E,6E)-7-(3-hexyl-1,1-dimethylbenzo[e]indol-3-ium-2-yl)hepta-2,4,6-trienylidene]-1,1-dimethylbenzo[e]indole.
| Compound Name | acetaldehyde;formaldehyde;(2Z)-3-hexyl-2-[(2E,4E,6E)-7-(3-hexyl-1,1-dimethylbenzo[e]indol-3-ium-2-yl)hepta-2,4,6-trienylidene]-1,1-dimethylbenzo[e]indole |
|---|---|
| PubChem CID | 144810967 |
| Molecular Formula | C50H63N2O2+ |
| Molecular Weight | 724.07 g/mol |
| Exact Mass | 723.49 |
| IUPAC Name | acetaldehyde;formaldehyde;(2Z)-3-hexyl-2-[(2E,4E,6E)-7-(3-hexyl-1,1-dimethylbenzo[e]indol-3-ium-2-yl)hepta-2,4,6-trienylidene]-1,1-dimethylbenzo[e]indole |
| SMILES | C=O.CC=O.CCCCCCN1/C(=C\C=C\C=C\C=C\C2=[N+](CCCCCC)c3ccc4ccccc4c3C2(C)C)C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C47H57N2.C2H4O.CH2O/c1-7-9-11-22-34-48-40-32-30-36-24-18-20-26-38(36)44(40)46(3,4)42(48)28-16-14-13-15-17-29-43-47(5,6)45-39-27-21-19-25-37(39)31-33-41(45)49(43)35-23-12-10-8-2;1-2-3;1-2/h13-21,24-33H,7-12,22-23,34-35H2,1-6H3;2H,1H3;1H2/q+1;; |
| InChIKey | IUQVEDGSWNVUAL-UHFFFAOYSA-N |
| XLogP | 12.90 |
| TPSA | 40.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.07 |
| LogP ≤ 5 | 12.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|