C48H59N2O2S+ — CID 170959759
8-[2-[(1E,3E,5E,7Z)-7-[1,1-dimethyl-3-(4-sulfanylbutyl)benzo[e]indol-2-ylidene]hepta-1,3,5-trienyl]-1,1-dimethylbenzo[e]indol-3-ium-3-yl]octan-3-one;methanol (PubChem CID 170959759) has the molecular formula C48H59N2O2S+ and a molecular weight of 728.08 g/mol. Its IUPAC name is 8-[2-[(1E,3E,5E,7Z)-7-[1,1-dimethyl-3-(4-sulfanylbutyl)benzo[e]indol-2-ylidene]hepta-1,3,5-trienyl]-1,1-dimethylbenzo[e]indol-3-ium-3-yl]octan-3-one;methanol.
| Compound Name | 8-[2-[(1E,3E,5E,7Z)-7-[1,1-dimethyl-3-(4-sulfanylbutyl)benzo[e]indol-2-ylidene]hepta-1,3,5-trienyl]-1,1-dimethylbenzo[e]indol-3-ium-3-yl]octan-3-one;methanol |
|---|---|
| PubChem CID | 170959759 |
| Molecular Formula | C48H59N2O2S+ |
| Molecular Weight | 728.08 g/mol |
| Exact Mass | 727.43 |
| IUPAC Name | 8-[2-[(1E,3E,5E,7Z)-7-[1,1-dimethyl-3-(4-sulfanylbutyl)benzo[e]indol-2-ylidene]hepta-1,3,5-trienyl]-1,1-dimethylbenzo[e]indol-3-ium-3-yl]octan-3-one;methanol |
| SMILES | CCC(=O)CCCCC[N+]1=C(/C=C/C=C/C=C/C=C2\N(CCCCS)c3ccc4ccccc4c3C2(C)C)C(C)(C)c2c1ccc1ccccc21.CO |
| InChI | InChI=1S/C47H54N2OS.CH4O/c1-6-37(50)23-11-10-18-32-48-40-30-28-35-21-14-16-24-38(35)44(40)46(2,3)42(48)26-12-8-7-9-13-27-43-47(4,5)45-39-25-17-15-22-36(39)29-31-41(45)49(43)33-19-20-34-51;1-2/h7-9,12-17,21-22,24-31H,6,10-11,18-20,23,32-34H2,1-5H3;2H,1H3/p+1 |
| InChIKey | CONYXFLAJXXUJY-UHFFFAOYSA-O |
| XLogP | 11.58 |
| TPSA | 43.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.08 |
| LogP ≤ 5 | 11.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|