C53H68N3O4S+ — CID 157246099
4-[2-[7-[1,1-dimethyl-3-[6-(octylamino)-6-oxohexyl]benzo[e]indol-3-ium-2-yl]hepta-2,4,6-trienylidene]-1,1-dimethylbenzo[e]indol-3-yl]butane-1-sulfonic acid (PubChem CID 157246099) has the molecular formula C53H68N3O4S+ and a molecular weight of 843.21 g/mol. Its IUPAC name is 4-[2-[7-[1,1-dimethyl-3-[6-(octylamino)-6-oxohexyl]benzo[e]indol-3-ium-2-yl]hepta-2,4,6-trienylidene]-1,1-dimethylbenzo[e]indol-3-yl]butane-1-sulfonic acid.
| Compound Name | 4-[2-[7-[1,1-dimethyl-3-[6-(octylamino)-6-oxohexyl]benzo[e]indol-3-ium-2-yl]hepta-2,4,6-trienylidene]-1,1-dimethylbenzo[e]indol-3-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 157246099 |
| Molecular Formula | C53H68N3O4S+ |
| Molecular Weight | 843.21 g/mol |
| Exact Mass | 842.49 |
| IUPAC Name | 4-[2-[7-[1,1-dimethyl-3-[6-(octylamino)-6-oxohexyl]benzo[e]indol-3-ium-2-yl]hepta-2,4,6-trienylidene]-1,1-dimethylbenzo[e]indol-3-yl]butane-1-sulfonic acid |
| SMILES | CCCCCCCCNC(=O)CCCCC[N+]1=C(C=CC=CC=CC=C2N(CCCCS(=O)(=O)O)c3ccc4ccccc4c3C2(C)C)C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C53H67N3O4S/c1-6-7-8-9-13-22-37-54-49(57)32-17-14-23-38-55-45-35-33-41-26-18-20-28-43(41)50(45)52(2,3)47(55)30-15-11-10-12-16-31-48-53(4,5)51-44-29-21-19-27-42(44)34-36-46(51)56(48)39-24-25-40-61(58,59)60/h10-12,15-16,18-21,26-31,33-36H,6-9,13-14,17,22-25,32,37-40H2,1-5H3,(H-,54,57,58,59,60)/p+1 |
| InChIKey | NATLALJKQLVLHG-UHFFFAOYSA-O |
| XLogP | 12.42 |
| TPSA | 89.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.21 |
| LogP ≤ 5 | 12.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|