C41H46N2NaO6S2 — CID 166600377
CID 166600377 (PubChem CID 166600377) has the molecular formula C41H46N2NaO6S2 and a molecular weight of 749.95 g/mol.
| Compound Name | CID 166600377 |
|---|---|
| PubChem CID | 166600377 |
| Molecular Formula | C41H46N2NaO6S2 |
| Molecular Weight | 749.95 g/mol |
| Exact Mass | 749.27 |
| IUPAC Name | — |
| SMILES | CC1(C)C(/C=C/C=C/C=C2/N(CCCCS(=O)(=O)[O-])c3ccc4ccccc4c3C2(C)C)=[N+](CCCCS(=O)(=O)O)c2ccc3ccccc3c21.[Na] |
| InChI | InChI=1S/C41H46N2O6S2.Na/c1-40(2)36(42(26-12-14-28-50(44,45)46)34-24-22-30-16-8-10-18-32(30)38(34)40)20-6-5-7-21-37-41(3,4)39-33-19-11-9-17-31(33)23-25-35(39)43(37)27-13-15-29-51(47,48)49;/h5-11,16-25H,12-15,26-29H2,1-4H3,(H-,44,45,46,47,48,49); |
| InChIKey | ZOYVHUDSHDNKLZ-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 117.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.95 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|