C38H47N2O6S2+ — CID 59086639
4-[2-[5-[1,1-dimethyl-3-(4-sulfobutyl)benzo[e]indol-3-ium-2-yl]penta-2,4-dienylidene]-3,3,5-trimethylindol-1-yl]butane-1-sulfonic acid (PubChem CID 59086639) has the molecular formula C38H47N2O6S2+ and a molecular weight of 691.94 g/mol. Its IUPAC name is 4-[2-[5-[1,1-dimethyl-3-(4-sulfobutyl)benzo[e]indol-3-ium-2-yl]penta-2,4-dienylidene]-3,3,5-trimethylindol-1-yl]butane-1-sulfonic acid.
| Compound Name | 4-[2-[5-[1,1-dimethyl-3-(4-sulfobutyl)benzo[e]indol-3-ium-2-yl]penta-2,4-dienylidene]-3,3,5-trimethylindol-1-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 59086639 |
| Molecular Formula | C38H47N2O6S2+ |
| Molecular Weight | 691.94 g/mol |
| Exact Mass | 691.29 |
| IUPAC Name | 4-[2-[5-[1,1-dimethyl-3-(4-sulfobutyl)benzo[e]indol-3-ium-2-yl]penta-2,4-dienylidene]-3,3,5-trimethylindol-1-yl]butane-1-sulfonic acid |
| SMILES | Cc1ccc2c(c1)C(C)(C)C(=CC=CC=CC1=[N+](CCCCS(=O)(=O)O)c3ccc4ccccc4c3C1(C)C)N2CCCCS(=O)(=O)O |
| InChI | InChI=1S/C38H46N2O6S2/c1-28-19-21-32-31(27-28)37(2,3)34(39(32)23-11-13-25-47(41,42)43)17-7-6-8-18-35-38(4,5)36-30-16-10-9-15-29(30)20-22-33(36)40(35)24-12-14-26-48(44,45)46/h6-10,15-22,27H,11-14,23-26H2,1-5H3,(H-,41,42,43,44,45,46)/p+1 |
| InChIKey | DDPDCMGKSYKPPX-UHFFFAOYSA-O |
| XLogP | 7.65 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.94 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|