C40H45N2O9S3+ — CID 162026399
(2Z)-1,1-dimethyl-3-(3-sulfopropyl)-2-[5-[1,1,7-trimethyl-3-(3-sulfopropyl)benzo[e]indol-3-ium-2-yl]penta-2,4-dienylidene]benzo[e]indole-7-sulfonic acid (PubChem CID 162026399) has the molecular formula C40H45N2O9S3+ and a molecular weight of 794.01 g/mol. Its IUPAC name is (2Z)-1,1-dimethyl-3-(3-sulfopropyl)-2-[5-[1,1,7-trimethyl-3-(3-sulfopropyl)benzo[e]indol-3-ium-2-yl]penta-2,4-dienylidene]benzo[e]indole-7-sulfonic acid.
| Compound Name | (2Z)-1,1-dimethyl-3-(3-sulfopropyl)-2-[5-[1,1,7-trimethyl-3-(3-sulfopropyl)benzo[e]indol-3-ium-2-yl]penta-2,4-dienylidene]benzo[e]indole-7-sulfonic acid |
|---|---|
| PubChem CID | 162026399 |
| Molecular Formula | C40H45N2O9S3+ |
| Molecular Weight | 794.01 g/mol |
| Exact Mass | 793.23 |
| IUPAC Name | (2Z)-1,1-dimethyl-3-(3-sulfopropyl)-2-[5-[1,1,7-trimethyl-3-(3-sulfopropyl)benzo[e]indol-3-ium-2-yl]penta-2,4-dienylidene]benzo[e]indole-7-sulfonic acid |
| SMILES | Cc1ccc2c3c(ccc2c1)[N+](CCCS(=O)(=O)O)=C(C=CC=C/C=C1\N(CCCS(=O)(=O)O)c2ccc4cc(S(=O)(=O)O)ccc4c2C1(C)C)C3(C)C |
| InChI | InChI=1S/C40H44N2O9S3/c1-27-13-17-31-28(25-27)14-19-33-37(31)39(2,3)35(41(33)21-9-23-52(43,44)45)11-7-6-8-12-36-40(4,5)38-32-18-16-30(54(49,50)51)26-29(32)15-20-34(38)42(36)22-10-24-53(46,47)48/h6-8,11-20,25-26H,9-10,21-24H2,1-5H3,(H2-,43,44,45,46,47,48,49,50,51)/p+1 |
| InChIKey | LQJDOCKPXVYQIY-UHFFFAOYSA-O |
| XLogP | 7.27 |
| TPSA | 169.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.01 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|